C31H43NO — CID 123439532
N-[4-(5-ethyl-3-methylcyclohexa-1,3-dien-1-yl)-6-pentoxy-2-propan-2-ylidenecyclohex-3-en-1-yl]-1-phenylethanimine (PubChem CID 123439532) has the molecular formula C31H43NO and a molecular weight of 445.69 g/mol. Its IUPAC name is N-[4-(5-ethyl-3-methylcyclohexa-1,3-dien-1-yl)-6-pentoxy-2-propan-2-ylidenecyclohex-3-en-1-yl]-1-phenylethanimine.
| Compound Name | N-[4-(5-ethyl-3-methylcyclohexa-1,3-dien-1-yl)-6-pentoxy-2-propan-2-ylidenecyclohex-3-en-1-yl]-1-phenylethanimine |
|---|---|
| PubChem CID | 123439532 |
| Molecular Formula | C31H43NO |
| Molecular Weight | 445.69 g/mol |
| Exact Mass | 445.33 |
| IUPAC Name | N-[4-(5-ethyl-3-methylcyclohexa-1,3-dien-1-yl)-6-pentoxy-2-propan-2-ylidenecyclohex-3-en-1-yl]-1-phenylethanimine |
| SMILES | CCCCCOC1CC(C2=CC(C)=CC(CC)C2)=CC(=C(C)C)C1/N=C(\C)c1ccccc1 |
| InChI | InChI=1S/C31H43NO/c1-7-9-13-16-33-30-21-28(27-18-23(5)17-25(8-2)19-27)20-29(22(3)4)31(30)32-24(6)26-14-11-10-12-15-26/h10-12,14-15,17-18,20,25,30-31H,7-9,13,16,19,21H2,1-6H3/b32-24+ |
| InChIKey | NVBGKHKLABLKGT-FEZSWGLMSA-N |
| XLogP | 8.41 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.69 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|