C10H15N — CID 123396486
N-[(3Z)-hepta-1,3,5-trien-2-yl]propan-1-imine (PubChem CID 123396486) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is N-[(3Z)-hepta-1,3,5-trien-2-yl]propan-1-imine.
| Compound Name | N-[(3Z)-hepta-1,3,5-trien-2-yl]propan-1-imine |
|---|---|
| PubChem CID | 123396486 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | N-[(3Z)-hepta-1,3,5-trien-2-yl]propan-1-imine |
| SMILES | C=C(/C=C\C=CC)/N=C/CC |
| InChI | InChI=1S/C10H15N/c1-4-6-7-8-10(3)11-9-5-2/h4,6-9H,3,5H2,1-2H3/b6-4?,8-7-,11-9+ |
| InChIKey | HDNUKPHMTMLLGF-BLZHIULCSA-N |
| XLogP | 3.11 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|