C22H27N7O2 — CID 123396756
cyclopentyl-[3-[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]oxypyrrolidin-1-yl]methanone (PubChem CID 123396756) has the molecular formula C22H27N7O2 and a molecular weight of 421.51 g/mol. Its IUPAC name is cyclopentyl-[3-[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]oxypyrrolidin-1-yl]methanone.
| Compound Name | cyclopentyl-[3-[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]oxypyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 123396756 |
| Molecular Formula | C22H27N7O2 |
| Molecular Weight | 421.51 g/mol |
| Exact Mass | 421.22 |
| IUPAC Name | cyclopentyl-[3-[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]oxypyrrolidin-1-yl]methanone |
| SMILES | CCn1c(-c2cnc(C)nc2)nc2c(OC3CCN(C(=O)C4CCCC4)C3)ncnc21 |
| InChI | InChI=1S/C22H27N7O2/c1-3-29-19(16-10-23-14(2)24-11-16)27-18-20(29)25-13-26-21(18)31-17-8-9-28(12-17)22(30)15-6-4-5-7-15/h10-11,13,15,17H,3-9,12H2,1-2H3 |
| InChIKey | YKJSVSIDEJVBOF-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 98.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.51 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |