C21H24IN9O2 — CID 90158723
[(3S)-3-[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]oxypyrrolidin-1-yl]-(3-methylimidazol-3-ium-1-yl)methanone iodide (PubChem CID 90158723) has the molecular formula C21H24IN9O2 and a molecular weight of 561.39 g/mol. Its IUPAC name is [(3S)-3-[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]oxypyrrolidin-1-yl]-(3-methylimidazol-3-ium-1-yl)methanone iodide.
| Compound Name | [(3S)-3-[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]oxypyrrolidin-1-yl]-(3-methylimidazol-3-ium-1-yl)methanone iodide |
|---|---|
| PubChem CID | 90158723 |
| Molecular Formula | C21H24IN9O2 |
| Molecular Weight | 561.39 g/mol |
| Exact Mass | 561.11 |
| IUPAC Name | [(3S)-3-[9-ethyl-8-(2-methylpyrimidin-5-yl)purin-6-yl]oxypyrrolidin-1-yl]-(3-methylimidazol-3-ium-1-yl)methanone iodide |
| SMILES | CCn1c(-c2cnc(C)nc2)nc2c(O[C@H]3CCN(C(=O)n4cc[n+](C)c4)C3)ncnc21.[I-] |
| InChI | InChI=1S/C21H24N9O2.HI/c1-4-30-18(15-9-22-14(2)23-10-15)26-17-19(30)24-12-25-20(17)32-16-5-6-28(11-16)21(31)29-8-7-27(3)13-29;/h7-10,12-13,16H,4-6,11H2,1-3H3;1H/q+1;/p-1/t16-;/m0./s1 |
| InChIKey | HVJZIVVMYSYOGU-NTISSMGPSA-M |
| XLogP | -1.64 |
| TPSA | 107.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.39 |
| LogP ≤ 5 | -1.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|