C19H25N7O3S — CID 144626802
9-ethyl-6-[(3S)-1-ethylsulfonylpiperidin-3-yl]oxy-8-(2-methylpyrimidin-5-yl)purine (PubChem CID 144626802) has the molecular formula C19H25N7O3S and a molecular weight of 431.52 g/mol. Its IUPAC name is 9-ethyl-6-[(3S)-1-ethylsulfonylpiperidin-3-yl]oxy-8-(2-methylpyrimidin-5-yl)purine.
| Compound Name | 9-ethyl-6-[(3S)-1-ethylsulfonylpiperidin-3-yl]oxy-8-(2-methylpyrimidin-5-yl)purine |
|---|---|
| PubChem CID | 144626802 |
| Molecular Formula | C19H25N7O3S |
| Molecular Weight | 431.52 g/mol |
| Exact Mass | 431.17 |
| IUPAC Name | 9-ethyl-6-[(3S)-1-ethylsulfonylpiperidin-3-yl]oxy-8-(2-methylpyrimidin-5-yl)purine |
| SMILES | CCn1c(-c2cnc(C)nc2)nc2c(O[C@H]3CCCN(S(=O)(=O)CC)C3)ncnc21 |
| InChI | InChI=1S/C19H25N7O3S/c1-4-26-17(14-9-20-13(3)21-10-14)24-16-18(26)22-12-23-19(16)29-15-7-6-8-25(11-15)30(27,28)5-2/h9-10,12,15H,4-8,11H2,1-3H3/t15-/m0/s1 |
| InChIKey | PCHULMQHBLQRMR-HNNXBMFYSA-N |
| XLogP | 1.80 |
| TPSA | 115.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.52 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |