C26H23N5 — CID 123397851
2-[2-[3-(1-methylpyrazol-4-yl)phenyl]ethyl]-6-naphthalen-2-ylpyrimidin-4-amine (PubChem CID 123397851) has the molecular formula C26H23N5 and a molecular weight of 405.51 g/mol. Its IUPAC name is 2-[2-[3-(1-methylpyrazol-4-yl)phenyl]ethyl]-6-naphthalen-2-ylpyrimidin-4-amine.
| Compound Name | 2-[2-[3-(1-methylpyrazol-4-yl)phenyl]ethyl]-6-naphthalen-2-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 123397851 |
| Molecular Formula | C26H23N5 |
| Molecular Weight | 405.51 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | 2-[2-[3-(1-methylpyrazol-4-yl)phenyl]ethyl]-6-naphthalen-2-ylpyrimidin-4-amine |
| SMILES | Cn1cc(-c2cccc(CCc3nc(N)cc(-c4ccc5ccccc5c4)n3)c2)cn1 |
| InChI | InChI=1S/C26H23N5/c1-31-17-23(16-28-31)20-8-4-5-18(13-20)9-12-26-29-24(15-25(27)30-26)22-11-10-19-6-2-3-7-21(19)14-22/h2-8,10-11,13-17H,9,12H2,1H3,(H2,27,29,30) |
| InChIKey | YQZLJOVGQQUWCK-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.51 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |