C16H30N3+ — CID 123397986
(2-amino-6-methanimidoyl-11-methyldodeca-5,7-dien-4-yl)-methyl-methylideneazanium (PubChem CID 123397986) has the molecular formula C16H30N3+ and a molecular weight of 264.44 g/mol. Its IUPAC name is (2-amino-6-methanimidoyl-11-methyldodeca-5,7-dien-4-yl)-methyl-methylideneazanium.
| Compound Name | (2-amino-6-methanimidoyl-11-methyldodeca-5,7-dien-4-yl)-methyl-methylideneazanium |
|---|---|
| PubChem CID | 123397986 |
| Molecular Formula | C16H30N3+ |
| Molecular Weight | 264.44 g/mol |
| Exact Mass | 264.24 |
| IUPAC Name | (2-amino-6-methanimidoyl-11-methyldodeca-5,7-dien-4-yl)-methyl-methylideneazanium |
| SMILES | [H]/N=C/C(C=CCCC(C)C)=CC(CC(C)N)[N+](=C)C |
| InChI | InChI=1S/C16H30N3/c1-13(2)8-6-7-9-15(12-17)11-16(19(4)5)10-14(3)18/h7,9,11-14,16-17H,4,6,8,10,18H2,1-3,5H3/q+1/b9-7?,15-11?,17-12+ |
| InChIKey | WDVZBUDKHGXPQP-HVBIKSOFSA-N |
| XLogP | 3.00 |
| TPSA | 52.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|