C17H31N3 — CID 145463012
1-N-[[4-(butyliminomethyl)cyclohexa-2,4-dien-1-yl]methyl]-3-methylbutane-1,3-diamine (PubChem CID 145463012) has the molecular formula C17H31N3 and a molecular weight of 277.46 g/mol. Its IUPAC name is 1-N-[[4-(butyliminomethyl)cyclohexa-2,4-dien-1-yl]methyl]-3-methylbutane-1,3-diamine.
| Compound Name | 1-N-[[4-(butyliminomethyl)cyclohexa-2,4-dien-1-yl]methyl]-3-methylbutane-1,3-diamine |
|---|---|
| PubChem CID | 145463012 |
| Molecular Formula | C17H31N3 |
| Molecular Weight | 277.46 g/mol |
| Exact Mass | 277.25 |
| IUPAC Name | 1-N-[[4-(butyliminomethyl)cyclohexa-2,4-dien-1-yl]methyl]-3-methylbutane-1,3-diamine |
| SMILES | CCCC/N=C/C1=CCC(CNCCC(C)(C)N)C=C1 |
| InChI | InChI=1S/C17H31N3/c1-4-5-11-19-13-15-6-8-16(9-7-15)14-20-12-10-17(2,3)18/h6-8,13,16,20H,4-5,9-12,14,18H2,1-3H3/b19-13+ |
| InChIKey | LSYHHHOTEFOCGV-CPNJWEJPSA-N |
| XLogP | 3.08 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|