C13H23N3 — CID 123398474
(3Z)-5-(4-methyl-1,4-diazepan-1-yl)hepta-3,5-dien-2-imine (PubChem CID 123398474) has the molecular formula C13H23N3 and a molecular weight of 221.35 g/mol. Its IUPAC name is (3Z)-5-(4-methyl-1,4-diazepan-1-yl)hepta-3,5-dien-2-imine.
| Compound Name | (3Z)-5-(4-methyl-1,4-diazepan-1-yl)hepta-3,5-dien-2-imine |
|---|---|
| PubChem CID | 123398474 |
| Molecular Formula | C13H23N3 |
| Molecular Weight | 221.35 g/mol |
| Exact Mass | 221.19 |
| IUPAC Name | (3Z)-5-(4-methyl-1,4-diazepan-1-yl)hepta-3,5-dien-2-imine |
| SMILES | [H]/N=C(C)/C=C\C(=CC)N1CCCN(C)CC1 |
| InChI | InChI=1S/C13H23N3/c1-4-13(7-6-12(2)14)16-9-5-8-15(3)10-11-16/h4,6-7,14H,5,8-11H2,1-3H3/b7-6-,13-4?,14-12+ |
| InChIKey | QEUPARJEFQYIHN-PAKFBWBPSA-N |
| XLogP | 2.12 |
| TPSA | 30.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.35 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|