C15H25N3 — CID 143028400
(4E,6E)-7-(4-methyl-1,4-diazepan-1-yl)nona-1,4,6,8-tetraen-4-amine (PubChem CID 143028400) has the molecular formula C15H25N3 and a molecular weight of 247.39 g/mol. Its IUPAC name is (4E,6E)-7-(4-methyl-1,4-diazepan-1-yl)nona-1,4,6,8-tetraen-4-amine.
| Compound Name | (4E,6E)-7-(4-methyl-1,4-diazepan-1-yl)nona-1,4,6,8-tetraen-4-amine |
|---|---|
| PubChem CID | 143028400 |
| Molecular Formula | C15H25N3 |
| Molecular Weight | 247.39 g/mol |
| Exact Mass | 247.20 |
| IUPAC Name | (4E,6E)-7-(4-methyl-1,4-diazepan-1-yl)nona-1,4,6,8-tetraen-4-amine |
| SMILES | C=CC/C(N)=C\C=C(/C=C)N1CCCN(C)CC1 |
| InChI | InChI=1S/C15H25N3/c1-4-7-14(16)8-9-15(5-2)18-11-6-10-17(3)12-13-18/h4-5,8-9H,1-2,6-7,10-13,16H2,3H3/b14-8+,15-9+ |
| InChIKey | LRCLXBMQTRLFDA-VOMDNODZSA-N |
| XLogP | 2.11 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.39 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|