C13H22 — CID 123400158
3,5-dimethylocta-2,4-dien-4-ylcyclopropane (PubChem CID 123400158) has the molecular formula C13H22 and a molecular weight of 178.32 g/mol. Its IUPAC name is 3,5-dimethylocta-2,4-dien-4-ylcyclopropane.
| Compound Name | 3,5-dimethylocta-2,4-dien-4-ylcyclopropane |
|---|---|
| PubChem CID | 123400158 |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | 3,5-dimethylocta-2,4-dien-4-ylcyclopropane |
| SMILES | CC=C(C)C(=C(C)CCC)C1CC1 |
| InChI | InChI=1S/C13H22/c1-5-7-11(4)13(10(3)6-2)12-8-9-12/h6,12H,5,7-9H2,1-4H3 |
| InChIKey | KFCFZAUVGAQXHK-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|