C13H24 — CID 123505419
5,6,7-trimethyldeca-2,6-diene (PubChem CID 123505419) has the molecular formula C13H24 and a molecular weight of 180.34 g/mol. Its IUPAC name is 5,6,7-trimethyldeca-2,6-diene.
| Compound Name | 5,6,7-trimethyldeca-2,6-diene |
|---|---|
| PubChem CID | 123505419 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.34 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | 5,6,7-trimethyldeca-2,6-diene |
| SMILES | CC=CCC(C)C(C)=C(C)CCC |
| InChI | InChI=1S/C13H24/c1-6-8-10-12(4)13(5)11(3)9-7-2/h6,8,12H,7,9-10H2,1-5H3 |
| InChIKey | YDBOLCBHCYPPJO-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.34 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|