About calcium;hydride;3-methylhept-5-en-2-one
calcium;hydride;3-methylhept-5-en-2-one (PubChem CID 175109385) has the molecular formula C8H16CaO
and a molecular weight of 168.29 g/mol. Its IUPAC name is calcium;hydride;3-methylhept-5-en-2-one.
Molecular Properties
| Compound Name | calcium;hydride;3-methylhept-5-en-2-one |
| PubChem CID | 175109385 |
| Molecular Formula | C8H16CaO |
| Molecular Weight | 168.29 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | calcium;hydride;3-methylhept-5-en-2-one |
| SMILES | CC=CCC(C)C(C)=O.[Ca+2].[H-].[H-] |
| InChI | InChI=1S/C8H14O.Ca.2H/c1-4-5-6-7(2)8(3)9;;;/h4-5,7H,6H2,1-3H3;;;/q;+2;2*-1 |
| InChIKey | BBTYDBLYZFYLFR-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.29 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze calcium;hydride;3-methylhept-5-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;hydride;3-methylhept-5-en-2-one?
The IUPAC name of calcium;hydride;3-methylhept-5-en-2-one (CID 175109385) is calcium;hydride;3-methylhept-5-en-2-one.
What is the SMILES notation for calcium;hydride;3-methylhept-5-en-2-one?
The canonical SMILES for calcium;hydride;3-methylhept-5-en-2-one is CC=CCC(C)C(C)=O.[Ca+2].[H-].[H-].
What is the InChIKey of calcium;hydride;3-methylhept-5-en-2-one?
The InChIKey is BBTYDBLYZFYLFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O.Ca.2H/c1-4-5-6-7(2)8(3)9;;;/h4-5,7H,6H2,1-3H3;;;/q;+2;2*-1.
What are the key properties of calcium;hydride;3-methylhept-5-en-2-one?
calcium;hydride;3-methylhept-5-en-2-one has a molecular weight of 168.29 g/mol, XLogP of 2.02, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;hydride;3-methylhept-5-en-2-one is sourced from PubChem (CID 175109385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).