C13H24O — CID 90350771
(Z,3S,5R)-3-ethyl-4,5-dimethylnon-7-en-2-one (PubChem CID 90350771) has the molecular formula C13H24O and a molecular weight of 196.33 g/mol. Its IUPAC name is (Z,3S,5R)-3-ethyl-4,5-dimethylnon-7-en-2-one.
| Compound Name | (Z,3S,5R)-3-ethyl-4,5-dimethylnon-7-en-2-one |
|---|---|
| PubChem CID | 90350771 |
| Molecular Formula | C13H24O |
| Molecular Weight | 196.33 g/mol |
| Exact Mass | 196.18 |
| IUPAC Name | (Z,3S,5R)-3-ethyl-4,5-dimethylnon-7-en-2-one |
| SMILES | C/C=C\C[C@@H](C)C(C)C(CC)C(C)=O |
| InChI | InChI=1S/C13H24O/c1-6-8-9-10(3)11(4)13(7-2)12(5)14/h6,8,10-11,13H,7,9H2,1-5H3/b8-6-/t10-,11?,13?/m1/s1 |
| InChIKey | ITYVPKVGQKJKRU-KECQIOHMSA-N |
| XLogP | 3.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.33 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|