C20H34 — CID 173098603
14,15,16-trimethylheptadeca-2,6,10,14-tetraene (PubChem CID 173098603) has the molecular formula C20H34 and a molecular weight of 274.49 g/mol. Its IUPAC name is 14,15,16-trimethylheptadeca-2,6,10,14-tetraene.
| Compound Name | 14,15,16-trimethylheptadeca-2,6,10,14-tetraene |
|---|---|
| PubChem CID | 173098603 |
| Molecular Formula | C20H34 |
| Molecular Weight | 274.49 g/mol |
| Exact Mass | 274.27 |
| IUPAC Name | 14,15,16-trimethylheptadeca-2,6,10,14-tetraene |
| SMILES | CC=CCCC=CCCC=CCCC(C)=C(C)C(C)C |
| InChI | InChI=1S/C20H34/c1-6-7-8-9-10-11-12-13-14-15-16-17-19(4)20(5)18(2)3/h6-7,10-11,14-15,18H,8-9,12-13,16-17H2,1-5H3 |
| InChIKey | ZEQOYLFZSSSZNF-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.49 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|