C25H44O3 — CID 123400369
heptyl 2-[3-(2,2,5,5-tetramethylhexan-3-yl)cyclohexa-1,5-dien-1-yl]oxyacetate (PubChem CID 123400369) has the molecular formula C25H44O3 and a molecular weight of 392.62 g/mol. Its IUPAC name is heptyl 2-[3-(2,2,5,5-tetramethylhexan-3-yl)cyclohexa-1,5-dien-1-yl]oxyacetate.
| Compound Name | heptyl 2-[3-(2,2,5,5-tetramethylhexan-3-yl)cyclohexa-1,5-dien-1-yl]oxyacetate |
|---|---|
| PubChem CID | 123400369 |
| Molecular Formula | C25H44O3 |
| Molecular Weight | 392.62 g/mol |
| Exact Mass | 392.33 |
| IUPAC Name | heptyl 2-[3-(2,2,5,5-tetramethylhexan-3-yl)cyclohexa-1,5-dien-1-yl]oxyacetate |
| SMILES | CCCCCCCOC(=O)COC1=CC(C(CC(C)(C)C)C(C)(C)C)CC=C1 |
| InChI | InChI=1S/C25H44O3/c1-8-9-10-11-12-16-27-23(26)19-28-21-15-13-14-20(17-21)22(25(5,6)7)18-24(2,3)4/h13,15,17,20,22H,8-12,14,16,18-19H2,1-7H3 |
| InChIKey | YUNWAYAMGJISOP-UHFFFAOYSA-N |
| XLogP | 7.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.62 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|