C22H19FN2O6 — CID 123400966
2-[3-[2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl]-2-oxopropyl]butanedioic acid (PubChem CID 123400966) has the molecular formula C22H19FN2O6 and a molecular weight of 426.40 g/mol. Its IUPAC name is 2-[3-[2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl]-2-oxopropyl]butanedioic acid.
| Compound Name | 2-[3-[2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl]-2-oxopropyl]butanedioic acid |
|---|---|
| PubChem CID | 123400966 |
| Molecular Formula | C22H19FN2O6 |
| Molecular Weight | 426.40 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | 2-[3-[2-fluoro-5-[(4-oxo-3H-phthalazin-1-yl)methyl]phenyl]-2-oxopropyl]butanedioic acid |
| SMILES | O=C(O)CC(CC(=O)Cc1cc(Cc2n[nH]c(=O)c3ccccc23)ccc1F)C(=O)O |
| InChI | InChI=1S/C22H19FN2O6/c23-18-6-5-12(8-19-16-3-1-2-4-17(16)21(29)25-24-19)7-13(18)9-15(26)10-14(22(30)31)11-20(27)28/h1-7,14H,8-11H2,(H,25,29)(H,27,28)(H,30,31) |
| InChIKey | FVBMJKHARJOZAA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 137.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.40 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |