C27H30FN3O4 — CID 173097782
2-[2-[N-fluoro-3-[(4-oxo-3H-phthalazin-1-yl)methyl]anilino]-2-oxoethyl]dec-4-enoic acid (PubChem CID 173097782) has the molecular formula C27H30FN3O4 and a molecular weight of 479.55 g/mol. Its IUPAC name is 2-[2-[N-fluoro-3-[(4-oxo-3H-phthalazin-1-yl)methyl]anilino]-2-oxoethyl]dec-4-enoic acid.
| Compound Name | 2-[2-[N-fluoro-3-[(4-oxo-3H-phthalazin-1-yl)methyl]anilino]-2-oxoethyl]dec-4-enoic acid |
|---|---|
| PubChem CID | 173097782 |
| Molecular Formula | C27H30FN3O4 |
| Molecular Weight | 479.55 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | 2-[2-[N-fluoro-3-[(4-oxo-3H-phthalazin-1-yl)methyl]anilino]-2-oxoethyl]dec-4-enoic acid |
| SMILES | CCCCCC=CCC(CC(=O)N(F)c1cccc(Cc2n[nH]c(=O)c3ccccc23)c1)C(=O)O |
| InChI | InChI=1S/C27H30FN3O4/c1-2-3-4-5-6-7-12-20(27(34)35)18-25(32)31(28)21-13-10-11-19(16-21)17-24-22-14-8-9-15-23(22)26(33)30-29-24/h6-11,13-16,20H,2-5,12,17-18H2,1H3,(H,30,33)(H,34,35) |
| InChIKey | RABFMBPCXOSMSN-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 103.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.55 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|