C19H26N2O4 — CID 123401261
methyl (2S)-3-(4-isocyanophenyl)-3-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoate (PubChem CID 123401261) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is methyl (2S)-3-(4-isocyanophenyl)-3-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoate.
| Compound Name | methyl (2S)-3-(4-isocyanophenyl)-3-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoate |
|---|---|
| PubChem CID | 123401261 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | methyl (2S)-3-(4-isocyanophenyl)-3-methyl-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]butanoate |
| SMILES | [C-]#[N+]c1ccc(C(C)(C)[C@@H](C(=O)OC)N(C)C(=O)OC(C)(C)C)cc1 |
| InChI | InChI=1S/C19H26N2O4/c1-18(2,3)25-17(23)21(7)15(16(22)24-8)19(4,5)13-9-11-14(20-6)12-10-13/h9-12,15H,1-5,7-8H3/t15-/m1/s1 |
| InChIKey | KIDSJRBWSUJKCJ-OAHLLOKOSA-N |
| XLogP | 3.92 |
| TPSA | 60.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|