C44H55NO12 — CID 123402698
[(3,5-dimethylbenzoyl)oxymethylamino]methyl 3,5-dimethylbenzoate;2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene (PubChem CID 123402698) has the molecular formula C44H55NO12 and a molecular weight of 789.92 g/mol. Its IUPAC name is [(3,5-dimethylbenzoyl)oxymethylamino]methyl 3,5-dimethylbenzoate;2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene.
| Compound Name | [(3,5-dimethylbenzoyl)oxymethylamino]methyl 3,5-dimethylbenzoate;2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene |
|---|---|
| PubChem CID | 123402698 |
| Molecular Formula | C44H55NO12 |
| Molecular Weight | 789.92 g/mol |
| Exact Mass | 789.37 |
| IUPAC Name | [(3,5-dimethylbenzoyl)oxymethylamino]methyl 3,5-dimethylbenzoate;2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene |
| SMILES | Cc1cc(C)cc(C(=O)OCNCOC(=O)c2cc(C)cc(C)c2)c1.c1ccc2c(c1)OCCOCCOCCOc1ccccc1OCCOCCOCCO2 |
| InChI | InChI=1S/C24H32O8.C20H23NO4/c1-2-6-22-21(5-1)29-17-13-25-9-10-27-15-19-31-23-7-3-4-8-24(23)32-20-16-28-12-11-26-14-18-30-22;1-13-5-14(2)8-17(7-13)19(22)24-11-21-12-25-20(23)18-9-15(3)6-16(4)10-18/h1-8H,9-20H2;5-10,21H,11-12H2,1-4H3 |
| InChIKey | GIAKGYCUVDKLPU-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 138.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 789.92 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|