C48H62F3NO15S — CID 46194404
3-[2-(3,5-dimethylbenzoyl)oxyethylamino]propyl 3,5-dimethylbenzoate;2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene;trifluoromethanesulfonic acid (PubChem CID 46194404) has the molecular formula C48H62F3NO15S and a molecular weight of 982.08 g/mol. Its IUPAC name is 3-[2-(3,5-dimethylbenzoyl)oxyethylamino]propyl 3,5-dimethylbenzoate;2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene;trifluoromethanesulfonic acid.
| Compound Name | 3-[2-(3,5-dimethylbenzoyl)oxyethylamino]propyl 3,5-dimethylbenzoate;2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene;trifluoromethanesulfonic acid |
|---|---|
| PubChem CID | 46194404 |
| Molecular Formula | C48H62F3NO15S |
| Molecular Weight | 982.08 g/mol |
| Exact Mass | 981.38 |
| IUPAC Name | 3-[2-(3,5-dimethylbenzoyl)oxyethylamino]propyl 3,5-dimethylbenzoate;2,5,8,11,18,21,24,27-octaoxatricyclo[26.4.0.012,17]dotriaconta-1(32),12,14,16,28,30-hexaene;trifluoromethanesulfonic acid |
| SMILES | Cc1cc(C)cc(C(=O)OCCCNCCOC(=O)c2cc(C)cc(C)c2)c1.O=S(=O)(O)C(F)(F)F.c1ccc2c(c1)OCCOCCOCCOc1ccccc1OCCOCCOCCO2 |
| InChI | InChI=1S/C24H32O8.C23H29NO4.CHF3O3S/c1-2-6-22-21(5-1)29-17-13-25-9-10-27-15-19-31-23-7-3-4-8-24(23)32-20-16-28-12-11-26-14-18-30-22;1-16-10-17(2)13-20(12-16)22(25)27-8-5-6-24-7-9-28-23(26)21-14-18(3)11-19(4)15-21;2-1(3,4)8(5,6)7/h1-8H,9-20H2;10-15,24H,5-9H2,1-4H3;(H,5,6,7) |
| InChIKey | GEYPWCPNZCPURP-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 192.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 68 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 982.08 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|