About methyl 3-chlorosilylpropanoate
methyl 3-chlorosilylpropanoate (PubChem CID 123403734) has the molecular formula C4H9ClO2Si
and a molecular weight of 152.65 g/mol. Its IUPAC name is methyl 3-chlorosilylpropanoate.
Molecular Properties
| Compound Name | methyl 3-chlorosilylpropanoate |
| PubChem CID | 123403734 |
| Molecular Formula | C4H9ClO2Si |
| Molecular Weight | 152.65 g/mol |
| Exact Mass | 152.01 |
| IUPAC Name | methyl 3-chlorosilylpropanoate |
| SMILES | COC(=O)CC[SiH2]Cl |
| InChI | InChI=1S/C4H9ClO2Si/c1-7-4(6)2-3-8-5/h2-3,8H2,1H3 |
| InChIKey | HWBLAQMAACUCAX-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.65 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-chlorosilylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-chlorosilylpropanoate?
The IUPAC name of methyl 3-chlorosilylpropanoate (CID 123403734) is methyl 3-chlorosilylpropanoate.
What is the SMILES notation for methyl 3-chlorosilylpropanoate?
The canonical SMILES for methyl 3-chlorosilylpropanoate is COC(=O)CC[SiH2]Cl.
What is the InChIKey of methyl 3-chlorosilylpropanoate?
The InChIKey is HWBLAQMAACUCAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9ClO2Si/c1-7-4(6)2-3-8-5/h2-3,8H2,1H3.
What are the key properties of methyl 3-chlorosilylpropanoate?
methyl 3-chlorosilylpropanoate has a molecular weight of 152.65 g/mol, XLogP of 0.29, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-chlorosilylpropanoate is sourced from PubChem (CID 123403734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).