C24H38 — CID 123404833
1,3a,4,10c-tetrahydrofluoranthene;ethane (PubChem CID 123404833) has the molecular formula C24H38 and a molecular weight of 326.57 g/mol. Its IUPAC name is 1,3a,4,10c-tetrahydrofluoranthene;ethane.
| Compound Name | 1,3a,4,10c-tetrahydrofluoranthene;ethane |
|---|---|
| PubChem CID | 123404833 |
| Molecular Formula | C24H38 |
| Molecular Weight | 326.57 g/mol |
| Exact Mass | 326.30 |
| IUPAC Name | 1,3a,4,10c-tetrahydrofluoranthene;ethane |
| SMILES | C1=CC2CC=CC3=c4ccccc4=C(C1)C32.CC.CC.CC.CC |
| InChI | InChI=1S/C16H14.4C2H6/c1-2-8-13-12(7-1)14-9-3-5-11-6-4-10-15(13)16(11)14;4*1-2/h1-5,7-8,10-11,16H,6,9H2;4*1-2H3 |
| InChIKey | SXRAODLNRCERPY-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.57 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|