C24H24O2 — CID 137316250
(3aR,4S,8aR)-4,8-dimethyl-2,2-diphenyl-4,5,8,8a-tetrahydro-3aH-cyclopenta[f][1,3]benzodioxole (PubChem CID 137316250) has the molecular formula C24H24O2 and a molecular weight of 344.45 g/mol. Its IUPAC name is (3aR,4S,8aR)-4,8-dimethyl-2,2-diphenyl-4,5,8,8a-tetrahydro-3aH-cyclopenta[f][1,3]benzodioxole.
| Compound Name | (3aR,4S,8aR)-4,8-dimethyl-2,2-diphenyl-4,5,8,8a-tetrahydro-3aH-cyclopenta[f][1,3]benzodioxole |
|---|---|
| PubChem CID | 137316250 |
| Molecular Formula | C24H24O2 |
| Molecular Weight | 344.45 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | (3aR,4S,8aR)-4,8-dimethyl-2,2-diphenyl-4,5,8,8a-tetrahydro-3aH-cyclopenta[f][1,3]benzodioxole |
| SMILES | CC1C2=C(CC=C2)[C@H](C)[C@H]2OC(c3ccccc3)(c3ccccc3)O[C@H]12 |
| InChI | InChI=1S/C24H24O2/c1-16-20-14-9-15-21(20)17(2)23-22(16)25-24(26-23,18-10-5-3-6-11-18)19-12-7-4-8-13-19/h3-14,16-17,22-23H,15H2,1-2H3/t16?,17-,22+,23+/m0/s1 |
| InChIKey | ADFHBOKAFIXFAW-AEBFXEGCSA-N |
| XLogP | 5.21 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.45 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |