C14H19NSi — CID 54172325
N-[dimethyl-(2-methylcyclopenta-1,3-dien-1-yl)silyl]aniline (PubChem CID 54172325) has the molecular formula C14H19NSi and a molecular weight of 229.40 g/mol. Its IUPAC name is N-[dimethyl-(2-methylcyclopenta-1,3-dien-1-yl)silyl]aniline.
| Compound Name | N-[dimethyl-(2-methylcyclopenta-1,3-dien-1-yl)silyl]aniline |
|---|---|
| PubChem CID | 54172325 |
| Molecular Formula | C14H19NSi |
| Molecular Weight | 229.40 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | N-[dimethyl-(2-methylcyclopenta-1,3-dien-1-yl)silyl]aniline |
| SMILES | CC1=C([Si](C)(C)Nc2ccccc2)CC=C1 |
| InChI | InChI=1S/C14H19NSi/c1-12-8-7-11-14(12)16(2,3)15-13-9-5-4-6-10-13/h4-10,15H,11H2,1-3H3 |
| InChIKey | OVWWSNJGVRFLIX-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.40 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|