About 2-methyloxirane;N-phenylaniline
2-methyloxirane;N-phenylaniline (PubChem CID 174992525) has the molecular formula C15H17NO
and a molecular weight of 227.31 g/mol. Its IUPAC name is 2-methyloxirane;N-phenylaniline.
Molecular Properties
| Compound Name | 2-methyloxirane;N-phenylaniline |
| PubChem CID | 174992525 |
| Molecular Formula | C15H17NO |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.13 |
| IUPAC Name | 2-methyloxirane;N-phenylaniline |
| SMILES | CC1CO1.c1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C12H11N.C3H6O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3-2-4-3/h1-10,13H;3H,2H2,1H3 |
| InChIKey | QVMJCEGSZCLKSK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 24.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-methyloxirane;N-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyloxirane;N-phenylaniline?
The IUPAC name of 2-methyloxirane;N-phenylaniline (CID 174992525) is 2-methyloxirane;N-phenylaniline.
What is the SMILES notation for 2-methyloxirane;N-phenylaniline?
The canonical SMILES for 2-methyloxirane;N-phenylaniline is CC1CO1.c1ccc(Nc2ccccc2)cc1.
What is the InChIKey of 2-methyloxirane;N-phenylaniline?
The InChIKey is QVMJCEGSZCLKSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N.C3H6O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3-2-4-3/h1-10,13H;3H,2H2,1H3.
What are the key properties of 2-methyloxirane;N-phenylaniline?
2-methyloxirane;N-phenylaniline has a molecular weight of 227.31 g/mol, XLogP of 3.84, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyloxirane;N-phenylaniline is sourced from PubChem (CID 174992525), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).