C32H36N4 — CID 130467285
1-N-[3-(4-anilinoanilino)-2,2,4,4-tetramethylcyclobutyl]-4-N-phenylbenzene-1,4-diamine (PubChem CID 130467285) has the molecular formula C32H36N4 and a molecular weight of 476.67 g/mol. Its IUPAC name is 1-N-[3-(4-anilinoanilino)-2,2,4,4-tetramethylcyclobutyl]-4-N-phenylbenzene-1,4-diamine.
| Compound Name | 1-N-[3-(4-anilinoanilino)-2,2,4,4-tetramethylcyclobutyl]-4-N-phenylbenzene-1,4-diamine |
|---|---|
| PubChem CID | 130467285 |
| Molecular Formula | C32H36N4 |
| Molecular Weight | 476.67 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | 1-N-[3-(4-anilinoanilino)-2,2,4,4-tetramethylcyclobutyl]-4-N-phenylbenzene-1,4-diamine |
| SMILES | CC1(C)C(Nc2ccc(Nc3ccccc3)cc2)C(C)(C)C1Nc1ccc(Nc2ccccc2)cc1 |
| InChI | InChI=1S/C32H36N4/c1-31(2)29(35-27-19-15-25(16-20-27)33-23-11-7-5-8-12-23)32(3,4)30(31)36-28-21-17-26(18-22-28)34-24-13-9-6-10-14-24/h5-22,29-30,33-36H,1-4H3 |
| InChIKey | DTHSTVRPPSAZBM-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.67 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_B(3)', 'substructure': 'N/A'} |
|---|