About N-diphenylsilyl-2-methyl-N-trimethylsilylcyclopenta-1,3-dien-1-amine
N-diphenylsilyl-2-methyl-N-trimethylsilylcyclopenta-1,3-dien-1-amine (PubChem CID 123796492) has the molecular formula C21H27NSi2
and a molecular weight of 349.63 g/mol. Its IUPAC name is N-diphenylsilyl-2-methyl-N-trimethylsilylcyclopenta-1,3-dien-1-amine.
Molecular Properties
| Compound Name | N-diphenylsilyl-2-methyl-N-trimethylsilylcyclopenta-1,3-dien-1-amine |
| PubChem CID | 123796492 |
| Molecular Formula | C21H27NSi2 |
| Molecular Weight | 349.63 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | N-diphenylsilyl-2-methyl-N-trimethylsilylcyclopenta-1,3-dien-1-amine |
| SMILES | CC1=C(N([SiH](c2ccccc2)c2ccccc2)[Si](C)(C)C)CC=C1 |
| InChI | InChI=1S/C21H27NSi2/c1-18-12-11-17-21(18)22(24(2,3)4)23(19-13-7-5-8-14-19)20-15-9-6-10-16-20/h5-16,23H,17H2,1-4H3 |
| InChIKey | ULJZPUUBOZJJTC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.63 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-diphenylsilyl-2-methyl-N-trimethylsilylcyclopenta-1,3-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-diphenylsilyl-2-methyl-N-trimethylsilylcyclopenta-1,3-dien-1-amine?
The IUPAC name of N-diphenylsilyl-2-methyl-N-trimethylsilylcyclopenta-1,3-dien-1-amine (CID 123796492) is N-diphenylsilyl-2-methyl-N-trimethylsilylcyclopenta-1,3-dien-1-amine.
What is the SMILES notation for N-diphenylsilyl-2-methyl-N-trimethylsilylcyclopenta-1,3-dien-1-amine?
The canonical SMILES for N-diphenylsilyl-2-methyl-N-trimethylsilylcyclopenta-1,3-dien-1-amine is CC1=C(N([SiH](c2ccccc2)c2ccccc2)[Si](C)(C)C)CC=C1.
What is the InChIKey of N-diphenylsilyl-2-methyl-N-trimethylsilylcyclopenta-1,3-dien-1-amine?
The InChIKey is ULJZPUUBOZJJTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27NSi2/c1-18-12-11-17-21(18)22(24(2,3)4)23(19-13-7-5-8-14-19)20-15-9-6-10-16-20/h5-16,23H,17H2,1-4H3.
What are the key properties of N-diphenylsilyl-2-methyl-N-trimethylsilylcyclopenta-1,3-dien-1-amine?
N-diphenylsilyl-2-methyl-N-trimethylsilylcyclopenta-1,3-dien-1-amine has a molecular weight of 349.63 g/mol, XLogP of 3.90, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-diphenylsilyl-2-methyl-N-trimethylsilylcyclopenta-1,3-dien-1-amine is sourced from PubChem (CID 123796492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).