C11H16 — CID 140983961
1,2,3-trimethyl-1,2,3,4-tetrahydropentalene (PubChem CID 140983961) has the molecular formula C11H16 and a molecular weight of 148.25 g/mol. Its IUPAC name is 1,2,3-trimethyl-1,2,3,4-tetrahydropentalene.
| Compound Name | 1,2,3-trimethyl-1,2,3,4-tetrahydropentalene |
|---|---|
| PubChem CID | 140983961 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | 1,2,3-trimethyl-1,2,3,4-tetrahydropentalene |
| SMILES | CC1C2=C(CC=C2)C(C)C1C |
| InChI | InChI=1S/C11H16/c1-7-8(2)10-5-4-6-11(10)9(7)3/h4-5,7-9H,6H2,1-3H3 |
| InChIKey | MJEWQYOSCSWTNY-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |