About 3-tert-butyl-1,3-dimethyl-2,6-dihydro-1H-pentalene
3-tert-butyl-1,3-dimethyl-2,6-dihydro-1H-pentalene (PubChem CID 141396806) has the molecular formula C14H22
and a molecular weight of 190.33 g/mol. Its IUPAC name is 3-tert-butyl-1,3-dimethyl-2,6-dihydro-1H-pentalene.
Analyze 3-tert-butyl-1,3-dimethyl-2,6-dihydro-1H-pentalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-1,3-dimethyl-2,6-dihydro-1H-pentalene?
The IUPAC name of 3-tert-butyl-1,3-dimethyl-2,6-dihydro-1H-pentalene (CID 141396806) is 3-tert-butyl-1,3-dimethyl-2,6-dihydro-1H-pentalene.
What is the SMILES notation for 3-tert-butyl-1,3-dimethyl-2,6-dihydro-1H-pentalene?
The canonical SMILES for 3-tert-butyl-1,3-dimethyl-2,6-dihydro-1H-pentalene is CC1CC(C)(C(C)(C)C)C2=C1CC=C2.
What is the InChIKey of 3-tert-butyl-1,3-dimethyl-2,6-dihydro-1H-pentalene?
The InChIKey is DAOSSFJHZPKBGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22/c1-10-9-14(5,13(2,3)4)12-8-6-7-11(10)12/h6,8,10H,7,9H2,1-5H3.
What are the key properties of 3-tert-butyl-1,3-dimethyl-2,6-dihydro-1H-pentalene?
3-tert-butyl-1,3-dimethyl-2,6-dihydro-1H-pentalene has a molecular weight of 190.33 g/mol, XLogP of 4.34, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-1,3-dimethyl-2,6-dihydro-1H-pentalene is sourced from PubChem (CID 141396806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).