C13H24 — CID 153317964
(3E)-3-(2,2-dimethylpropylidene)-1,1,4-trimethylcyclopentane (PubChem CID 153317964) has the molecular formula C13H24 and a molecular weight of 180.33 g/mol. Its IUPAC name is (3E)-3-(2,2-dimethylpropylidene)-1,1,4-trimethylcyclopentane.
| Compound Name | (3E)-3-(2,2-dimethylpropylidene)-1,1,4-trimethylcyclopentane |
|---|---|
| PubChem CID | 153317964 |
| Molecular Formula | C13H24 |
| Molecular Weight | 180.33 g/mol |
| Exact Mass | 180.19 |
| IUPAC Name | (3E)-3-(2,2-dimethylpropylidene)-1,1,4-trimethylcyclopentane |
| SMILES | CC1CC(C)(C)C/C1=C\C(C)(C)C |
| InChI | InChI=1S/C13H24/c1-10-7-13(5,6)9-11(10)8-12(2,3)4/h8,10H,7,9H2,1-6H3/b11-8+ |
| InChIKey | WGLLGAKBXSNTAG-DHZHZOJOSA-N |
| XLogP | 4.41 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.33 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|