C10H12O — CID 123762161
4-methoxy-4,5-dihydro-1H-indene (PubChem CID 123762161) has the molecular formula C10H12O and a molecular weight of 148.20 g/mol. Its IUPAC name is 4-methoxy-4,5-dihydro-1H-indene.
| Compound Name | 4-methoxy-4,5-dihydro-1H-indene |
|---|---|
| PubChem CID | 123762161 |
| Molecular Formula | C10H12O |
| Molecular Weight | 148.20 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | 4-methoxy-4,5-dihydro-1H-indene |
| SMILES | COC1CC=CC2=C1C=CC2 |
| InChI | InChI=1S/C10H12O/c1-11-10-7-3-5-8-4-2-6-9(8)10/h2-3,5-6,10H,4,7H2,1H3 |
| InChIKey | OICMZUKZLRZBEU-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.20 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |