C11H16 — CID 58622710
(5S,6S)-5,6-dimethyl-4,5,6,7-tetrahydro-1H-indene (PubChem CID 58622710) has the molecular formula C11H16 and a molecular weight of 148.25 g/mol. Its IUPAC name is (5S,6S)-5,6-dimethyl-4,5,6,7-tetrahydro-1H-indene.
| Compound Name | (5S,6S)-5,6-dimethyl-4,5,6,7-tetrahydro-1H-indene |
|---|---|
| PubChem CID | 58622710 |
| Molecular Formula | C11H16 |
| Molecular Weight | 148.25 g/mol |
| Exact Mass | 148.13 |
| IUPAC Name | (5S,6S)-5,6-dimethyl-4,5,6,7-tetrahydro-1H-indene |
| SMILES | C[C@H]1CC2=C(CC=C2)C[C@@H]1C |
| InChI | InChI=1S/C11H16/c1-8-6-10-4-3-5-11(10)7-9(8)2/h3-4,8-9H,5-7H2,1-2H3/t8-,9-/m0/s1 |
| InChIKey | BRNJLAHNESIEQO-IUCAKERBSA-N |
| XLogP | 3.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.25 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |