About 3,6-dihydro-1H-cyclopenta[c]pyrrol-2-ide;tungsten
3,6-dihydro-1H-cyclopenta[c]pyrrol-2-ide;tungsten (PubChem CID 160620115) has the molecular formula C7H8NW-
and a molecular weight of 289.99 g/mol. Its IUPAC name is 3,6-dihydro-1H-cyclopenta[c]pyrrol-2-ide;tungsten.
Analyze 3,6-dihydro-1H-cyclopenta[c]pyrrol-2-ide;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,6-dihydro-1H-cyclopenta[c]pyrrol-2-ide;tungsten?
The IUPAC name of 3,6-dihydro-1H-cyclopenta[c]pyrrol-2-ide;tungsten (CID 160620115) is 3,6-dihydro-1H-cyclopenta[c]pyrrol-2-ide;tungsten.
What is the SMILES notation for 3,6-dihydro-1H-cyclopenta[c]pyrrol-2-ide;tungsten?
The canonical SMILES for 3,6-dihydro-1H-cyclopenta[c]pyrrol-2-ide;tungsten is C1=CC2=C(C1)C[N-]C2.[W].
What is the InChIKey of 3,6-dihydro-1H-cyclopenta[c]pyrrol-2-ide;tungsten?
The InChIKey is QBMADLLYNYHEHS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N.W/c1-2-6-4-8-5-7(6)3-1;/h1-2H,3-5H2;/q-1;.
What are the key properties of 3,6-dihydro-1H-cyclopenta[c]pyrrol-2-ide;tungsten?
3,6-dihydro-1H-cyclopenta[c]pyrrol-2-ide;tungsten has a molecular weight of 289.99 g/mol, XLogP of 1.63, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3,6-dihydro-1H-cyclopenta[c]pyrrol-2-ide;tungsten is sourced from PubChem (CID 160620115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).