C10H18P4 — CID 58622787
diphosphanyl-[(4S,5S)-4-methyl-4,5,6,7-tetrahydro-3H-inden-5-yl]-phosphanylphosphane (PubChem CID 58622787) has the molecular formula C10H18P4 and a molecular weight of 262.15 g/mol. Its IUPAC name is diphosphanyl-[(4S,5S)-4-methyl-4,5,6,7-tetrahydro-3H-inden-5-yl]-phosphanylphosphane.
| Compound Name | diphosphanyl-[(4S,5S)-4-methyl-4,5,6,7-tetrahydro-3H-inden-5-yl]-phosphanylphosphane |
|---|---|
| PubChem CID | 58622787 |
| Molecular Formula | C10H18P4 |
| Molecular Weight | 262.15 g/mol |
| Exact Mass | 262.04 |
| IUPAC Name | diphosphanyl-[(4S,5S)-4-methyl-4,5,6,7-tetrahydro-3H-inden-5-yl]-phosphanylphosphane |
| SMILES | C[C@H]1C2=C(C=CC2)CC[C@@H]1P(P)PP |
| InChI | InChI=1S/C10H18P4/c1-7-9-4-2-3-8(9)5-6-10(7)14(12)13-11/h2-3,7,10,13H,4-6,11-12H2,1H3/t7-,10-,14?/m0/s1 |
| InChIKey | UBSFPYUOZXTABT-PJJNAJQESA-N |
| XLogP | 4.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.15 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|