C11H18P4 — CID 21061778
diphosphanyl-(2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)-phosphanylphosphane (PubChem CID 21061778) has the molecular formula C11H18P4 and a molecular weight of 274.16 g/mol. Its IUPAC name is diphosphanyl-(2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)-phosphanylphosphane.
| Compound Name | diphosphanyl-(2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)-phosphanylphosphane |
|---|---|
| PubChem CID | 21061778 |
| Molecular Formula | C11H18P4 |
| Molecular Weight | 274.16 g/mol |
| Exact Mass | 274.04 |
| IUPAC Name | diphosphanyl-(2-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)-phosphanylphosphane |
| SMILES | CC1CCc2ccccc2C1P(P)PP |
| InChI | InChI=1S/C11H18P4/c1-8-6-7-9-4-2-3-5-10(9)11(8)15(13)14-12/h2-5,8,11,14H,6-7,12-13H2,1H3 |
| InChIKey | DZWSAIJDMHUCMF-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.16 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|