C21H26Si — CID 159423577
[(1S)-2,3-dihydro-1H-inden-1-yl]-dimethyl-[(1S)-2-methyl-2,3-dihydro-1H-inden-1-yl]silane (PubChem CID 159423577) has the molecular formula C21H26Si and a molecular weight of 306.52 g/mol. Its IUPAC name is [(1S)-2,3-dihydro-1H-inden-1-yl]-dimethyl-[(1S)-2-methyl-2,3-dihydro-1H-inden-1-yl]silane.
| Compound Name | [(1S)-2,3-dihydro-1H-inden-1-yl]-dimethyl-[(1S)-2-methyl-2,3-dihydro-1H-inden-1-yl]silane |
|---|---|
| PubChem CID | 159423577 |
| Molecular Formula | C21H26Si |
| Molecular Weight | 306.52 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | [(1S)-2,3-dihydro-1H-inden-1-yl]-dimethyl-[(1S)-2-methyl-2,3-dihydro-1H-inden-1-yl]silane |
| SMILES | CC1Cc2ccccc2[C@H]1[Si](C)(C)[C@H]1CCc2ccccc21 |
| InChI | InChI=1S/C21H26Si/c1-15-14-17-9-5-7-11-19(17)21(15)22(2,3)20-13-12-16-8-4-6-10-18(16)20/h4-11,15,20-21H,12-14H2,1-3H3/t15?,20-,21-/m0/s1 |
| InChIKey | JBDGAUQZVDWHJK-LBTAZEDMSA-N |
| XLogP | 5.48 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.52 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|