C7H18P4 — CID 58622694
diphosphanyl-[(1S,2S)-2-methylcyclohexyl]-phosphanylphosphane (PubChem CID 58622694) has the molecular formula C7H18P4 and a molecular weight of 226.12 g/mol. Its IUPAC name is diphosphanyl-[(1S,2S)-2-methylcyclohexyl]-phosphanylphosphane.
| Compound Name | diphosphanyl-[(1S,2S)-2-methylcyclohexyl]-phosphanylphosphane |
|---|---|
| PubChem CID | 58622694 |
| Molecular Formula | C7H18P4 |
| Molecular Weight | 226.12 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | diphosphanyl-[(1S,2S)-2-methylcyclohexyl]-phosphanylphosphane |
| SMILES | C[C@H]1CCCC[C@@H]1P(P)PP |
| InChI | InChI=1S/C7H18P4/c1-6-4-2-3-5-7(6)11(9)10-8/h6-7,10H,2-5,8-9H2,1H3/t6-,7-,11?/m0/s1 |
| InChIKey | YJNQVGGIASRDQJ-YKFGJVJNSA-N |
| XLogP | 4.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.12 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|