About diphosphanyl-[(1S,2S)-2-methylcyclohexyl]-phosphanylphosphane
diphosphanyl-[(1S,2S)-2-methylcyclohexyl]-phosphanylphosphane (PubChem CID 58622694) has the molecular formula C7H18P4
and a molecular weight of 226.12 g/mol. Its IUPAC name is diphosphanyl-[(1S,2S)-2-methylcyclohexyl]-phosphanylphosphane.
Molecular Properties
| Compound Name | diphosphanyl-[(1S,2S)-2-methylcyclohexyl]-phosphanylphosphane |
| PubChem CID | 58622694 |
| Molecular Formula | C7H18P4 |
| Molecular Weight | 226.12 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | diphosphanyl-[(1S,2S)-2-methylcyclohexyl]-phosphanylphosphane |
| SMILES | C[C@H]1CCCC[C@@H]1P(P)PP |
| InChI | InChI=1S/C7H18P4/c1-6-4-2-3-5-7(6)11(9)10-8/h6-7,10H,2-5,8-9H2,1H3/t6-,7-,11?/m0/s1 |
| InChIKey | YJNQVGGIASRDQJ-YKFGJVJNSA-N |
| XLogP | 4.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.12 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diphosphanyl-[(1S,2S)-2-methylcyclohexyl]-phosphanylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphosphanyl-[(1S,2S)-2-methylcyclohexyl]-phosphanylphosphane?
The IUPAC name of diphosphanyl-[(1S,2S)-2-methylcyclohexyl]-phosphanylphosphane (CID 58622694) is diphosphanyl-[(1S,2S)-2-methylcyclohexyl]-phosphanylphosphane.
What is the SMILES notation for diphosphanyl-[(1S,2S)-2-methylcyclohexyl]-phosphanylphosphane?
The canonical SMILES for diphosphanyl-[(1S,2S)-2-methylcyclohexyl]-phosphanylphosphane is C[C@H]1CCCC[C@@H]1P(P)PP.
What is the InChIKey of diphosphanyl-[(1S,2S)-2-methylcyclohexyl]-phosphanylphosphane?
The InChIKey is YJNQVGGIASRDQJ-YKFGJVJNSA-N. The full InChI is InChI=1S/C7H18P4/c1-6-4-2-3-5-7(6)11(9)10-8/h6-7,10H,2-5,8-9H2,1H3/t6-,7-,11?/m0/s1.
What are the key properties of diphosphanyl-[(1S,2S)-2-methylcyclohexyl]-phosphanylphosphane?
diphosphanyl-[(1S,2S)-2-methylcyclohexyl]-phosphanylphosphane has a molecular weight of 226.12 g/mol, XLogP of 4.22, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for diphosphanyl-[(1S,2S)-2-methylcyclohexyl]-phosphanylphosphane is sourced from PubChem (CID 58622694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).