C6H16OP4 — CID 58845408
diphosphanyl-[(2S,3S)-3-methyloxan-2-yl]-phosphanylphosphane (PubChem CID 58845408) has the molecular formula C6H16OP4 and a molecular weight of 228.09 g/mol. Its IUPAC name is diphosphanyl-[(2S,3S)-3-methyloxan-2-yl]-phosphanylphosphane.
| Compound Name | diphosphanyl-[(2S,3S)-3-methyloxan-2-yl]-phosphanylphosphane |
|---|---|
| PubChem CID | 58845408 |
| Molecular Formula | C6H16OP4 |
| Molecular Weight | 228.09 g/mol |
| Exact Mass | 228.02 |
| IUPAC Name | diphosphanyl-[(2S,3S)-3-methyloxan-2-yl]-phosphanylphosphane |
| SMILES | C[C@H]1CCCO[C@H]1P(P)PP |
| InChI | InChI=1S/C6H16OP4/c1-5-3-2-4-7-6(5)11(9)10-8/h5-6,10H,2-4,8-9H2,1H3/t5-,6-,11?/m0/s1 |
| InChIKey | FXCACYLOKGRINV-KNNPZSQVSA-N |
| XLogP | 3.41 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.09 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|