C5H14OP4 — CID 58622788
diphosphanyl-[(2R,3S)-2-methyloxolan-3-yl]-phosphanylphosphane (PubChem CID 58622788) has the molecular formula C5H14OP4 and a molecular weight of 214.06 g/mol. Its IUPAC name is diphosphanyl-[(2R,3S)-2-methyloxolan-3-yl]-phosphanylphosphane.
| Compound Name | diphosphanyl-[(2R,3S)-2-methyloxolan-3-yl]-phosphanylphosphane |
|---|---|
| PubChem CID | 58622788 |
| Molecular Formula | C5H14OP4 |
| Molecular Weight | 214.06 g/mol |
| Exact Mass | 214.00 |
| IUPAC Name | diphosphanyl-[(2R,3S)-2-methyloxolan-3-yl]-phosphanylphosphane |
| SMILES | C[C@H]1OCC[C@@H]1P(P)PP |
| InChI | InChI=1S/C5H14OP4/c1-4-5(2-3-6-4)10(8)9-7/h4-5,9H,2-3,7-8H2,1H3/t4-,5+,10?/m1/s1 |
| InChIKey | NHOILHAIDVOCMK-LESHHQLCSA-N |
| XLogP | 2.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.06 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|