About diphosphanyl-[(2R,3S)-2-methyloxolan-3-yl]-phosphanylphosphane
diphosphanyl-[(2R,3S)-2-methyloxolan-3-yl]-phosphanylphosphane (PubChem CID 58622788) has the molecular formula C5H14OP4
and a molecular weight of 214.06 g/mol. Its IUPAC name is diphosphanyl-[(2R,3S)-2-methyloxolan-3-yl]-phosphanylphosphane.
Molecular Properties
| Compound Name | diphosphanyl-[(2R,3S)-2-methyloxolan-3-yl]-phosphanylphosphane |
| PubChem CID | 58622788 |
| Molecular Formula | C5H14OP4 |
| Molecular Weight | 214.06 g/mol |
| Exact Mass | 214.00 |
| IUPAC Name | diphosphanyl-[(2R,3S)-2-methyloxolan-3-yl]-phosphanylphosphane |
| SMILES | C[C@H]1OCC[C@@H]1P(P)PP |
| InChI | InChI=1S/C5H14OP4/c1-4-5(2-3-6-4)10(8)9-7/h4-5,9H,2-3,7-8H2,1H3/t4-,5+,10?/m1/s1 |
| InChIKey | NHOILHAIDVOCMK-LESHHQLCSA-N |
| XLogP | 2.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.06 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diphosphanyl-[(2R,3S)-2-methyloxolan-3-yl]-phosphanylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diphosphanyl-[(2R,3S)-2-methyloxolan-3-yl]-phosphanylphosphane?
The IUPAC name of diphosphanyl-[(2R,3S)-2-methyloxolan-3-yl]-phosphanylphosphane (CID 58622788) is diphosphanyl-[(2R,3S)-2-methyloxolan-3-yl]-phosphanylphosphane.
What is the SMILES notation for diphosphanyl-[(2R,3S)-2-methyloxolan-3-yl]-phosphanylphosphane?
The canonical SMILES for diphosphanyl-[(2R,3S)-2-methyloxolan-3-yl]-phosphanylphosphane is C[C@H]1OCC[C@@H]1P(P)PP.
What is the InChIKey of diphosphanyl-[(2R,3S)-2-methyloxolan-3-yl]-phosphanylphosphane?
The InChIKey is NHOILHAIDVOCMK-LESHHQLCSA-N. The full InChI is InChI=1S/C5H14OP4/c1-4-5(2-3-6-4)10(8)9-7/h4-5,9H,2-3,7-8H2,1H3/t4-,5+,10?/m1/s1.
What are the key properties of diphosphanyl-[(2R,3S)-2-methyloxolan-3-yl]-phosphanylphosphane?
diphosphanyl-[(2R,3S)-2-methyloxolan-3-yl]-phosphanylphosphane has a molecular weight of 214.06 g/mol, XLogP of 2.82, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for diphosphanyl-[(2R,3S)-2-methyloxolan-3-yl]-phosphanylphosphane is sourced from PubChem (CID 58622788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).