C23H24FN5O3 — CID 123405624
1-[4-amino-5-[amino-(4-fluorophenyl)methyl]-6-formyl-2-pyridinyl]-3-(2-hydroxy-1-phenylpropyl)urea (PubChem CID 123405624) has the molecular formula C23H24FN5O3 and a molecular weight of 437.48 g/mol. Its IUPAC name is 1-[4-amino-5-[amino-(4-fluorophenyl)methyl]-6-formyl-2-pyridinyl]-3-(2-hydroxy-1-phenylpropyl)urea.
| Compound Name | 1-[4-amino-5-[amino-(4-fluorophenyl)methyl]-6-formyl-2-pyridinyl]-3-(2-hydroxy-1-phenylpropyl)urea |
|---|---|
| PubChem CID | 123405624 |
| Molecular Formula | C23H24FN5O3 |
| Molecular Weight | 437.48 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 1-[4-amino-5-[amino-(4-fluorophenyl)methyl]-6-formyl-2-pyridinyl]-3-(2-hydroxy-1-phenylpropyl)urea |
| SMILES | CC(O)C(NC(=O)Nc1cc(N)c(C(N)c2ccc(F)cc2)c(C=O)n1)c1ccccc1 |
| InChI | InChI=1S/C23H24FN5O3/c1-13(31)22(15-5-3-2-4-6-15)29-23(32)28-19-11-17(25)20(18(12-30)27-19)21(26)14-7-9-16(24)10-8-14/h2-13,21-22,31H,26H2,1H3,(H4,25,27,28,29,32) |
| InChIKey | CESISRYAJLOJQL-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 143.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.48 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|