C21H20N4 — CID 123405869
4-(7,8-dihydro-5H-1,6-naphthyridin-6-ylmethyl)-2-[1-(methylideneamino)buta-1,3-dienyl]benzonitrile (PubChem CID 123405869) has the molecular formula C21H20N4 and a molecular weight of 328.42 g/mol. Its IUPAC name is 4-(7,8-dihydro-5H-1,6-naphthyridin-6-ylmethyl)-2-[1-(methylideneamino)buta-1,3-dienyl]benzonitrile.
| Compound Name | 4-(7,8-dihydro-5H-1,6-naphthyridin-6-ylmethyl)-2-[1-(methylideneamino)buta-1,3-dienyl]benzonitrile |
|---|---|
| PubChem CID | 123405869 |
| Molecular Formula | C21H20N4 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | 4-(7,8-dihydro-5H-1,6-naphthyridin-6-ylmethyl)-2-[1-(methylideneamino)buta-1,3-dienyl]benzonitrile |
| SMILES | C=CC=C(N=C)c1cc(CN2CCc3ncccc3C2)ccc1C#N |
| InChI | InChI=1S/C21H20N4/c1-3-5-21(23-2)19-12-16(7-8-17(19)13-22)14-25-11-9-20-18(15-25)6-4-10-24-20/h3-8,10,12H,1-2,9,11,14-15H2 |
| InChIKey | QOKCOMWLMWMIOP-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 52.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|