C21H23N3O3 — CID 154000672
1-[[4-(7,8-dihydro-5H-1,6-naphthyridin-6-ylmethyl)phenyl]methoxy]piperidine-2,6-dione (PubChem CID 154000672) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is 1-[[4-(7,8-dihydro-5H-1,6-naphthyridin-6-ylmethyl)phenyl]methoxy]piperidine-2,6-dione.
| Compound Name | 1-[[4-(7,8-dihydro-5H-1,6-naphthyridin-6-ylmethyl)phenyl]methoxy]piperidine-2,6-dione |
|---|---|
| PubChem CID | 154000672 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | 1-[[4-(7,8-dihydro-5H-1,6-naphthyridin-6-ylmethyl)phenyl]methoxy]piperidine-2,6-dione |
| SMILES | O=C1CCCC(=O)N1OCc1ccc(CN2CCc3ncccc3C2)cc1 |
| InChI | InChI=1S/C21H23N3O3/c25-20-4-1-5-21(26)24(20)27-15-17-8-6-16(7-9-17)13-23-12-10-19-18(14-23)3-2-11-22-19/h2-3,6-9,11H,1,4-5,10,12-15H2 |
| InChIKey | QRQBDACFCYGYRN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|