C22H33O5P — CID 123406645
(3-tert-butyl-3-oxo-2H-1,3λ5-benzoxaphosphol-4-yl) (5-methyl-2-propan-2-ylcyclohexyl) carbonate (PubChem CID 123406645) has the molecular formula C22H33O5P and a molecular weight of 408.48 g/mol. Its IUPAC name is (3-tert-butyl-3-oxo-2H-1,3λ5-benzoxaphosphol-4-yl) (5-methyl-2-propan-2-ylcyclohexyl) carbonate.
| Compound Name | (3-tert-butyl-3-oxo-2H-1,3λ5-benzoxaphosphol-4-yl) (5-methyl-2-propan-2-ylcyclohexyl) carbonate |
|---|---|
| PubChem CID | 123406645 |
| Molecular Formula | C22H33O5P |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | (3-tert-butyl-3-oxo-2H-1,3λ5-benzoxaphosphol-4-yl) (5-methyl-2-propan-2-ylcyclohexyl) carbonate |
| SMILES | CC1CCC(C(C)C)C(OC(=O)Oc2cccc3c2P(=O)(C(C)(C)C)CO3)C1 |
| InChI | InChI=1S/C22H33O5P/c1-14(2)16-11-10-15(3)12-19(16)27-21(23)26-18-9-7-8-17-20(18)28(24,13-25-17)22(4,5)6/h7-9,14-16,19H,10-13H2,1-6H3 |
| InChIKey | QELCWTRXIUZNRC-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|