C23H35O6P — CID 139125423
[(3R)-3-tert-butyl-4-methoxy-3-oxo-2H-1,3λ5-benzoxaphosphol-6-yl] [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] carbonate (PubChem CID 139125423) has the molecular formula C23H35O6P and a molecular weight of 438.50 g/mol. Its IUPAC name is [(3R)-3-tert-butyl-4-methoxy-3-oxo-2H-1,3λ5-benzoxaphosphol-6-yl] [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] carbonate.
| Compound Name | [(3R)-3-tert-butyl-4-methoxy-3-oxo-2H-1,3λ5-benzoxaphosphol-6-yl] [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] carbonate |
|---|---|
| PubChem CID | 139125423 |
| Molecular Formula | C23H35O6P |
| Molecular Weight | 438.50 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | [(3R)-3-tert-butyl-4-methoxy-3-oxo-2H-1,3λ5-benzoxaphosphol-6-yl] [(1S,2R,5S)-5-methyl-2-propan-2-ylcyclohexyl] carbonate |
| SMILES | COc1cc(OC(=O)O[C@H]2C[C@@H](C)CC[C@@H]2C(C)C)cc2c1[P@](=O)(C(C)(C)C)CO2 |
| InChI | InChI=1S/C23H35O6P/c1-14(2)17-9-8-15(3)10-18(17)29-22(24)28-16-11-19(26-7)21-20(12-16)27-13-30(21,25)23(4,5)6/h11-12,14-15,17-18H,8-10,13H2,1-7H3/t15-,17+,18-,30-/m0/s1 |
| InChIKey | LRHUTQJKVGNDEP-LVGHGAIUSA-N |
| XLogP | 5.81 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.50 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|