About 5-ethyl-3,11-dimethyltridec-5-ene
5-ethyl-3,11-dimethyltridec-5-ene (PubChem CID 123408628) has the molecular formula C17H34
and a molecular weight of 238.46 g/mol. Its IUPAC name is 5-ethyl-3,11-dimethyltridec-5-ene.
Molecular Properties
| Compound Name | 5-ethyl-3,11-dimethyltridec-5-ene |
| PubChem CID | 123408628 |
| Molecular Formula | C17H34 |
| Molecular Weight | 238.46 g/mol |
| Exact Mass | 238.27 |
| IUPAC Name | 5-ethyl-3,11-dimethyltridec-5-ene |
| SMILES | CCC(=CCCCCC(C)CC)CC(C)CC |
| InChI | InChI=1S/C17H34/c1-6-15(4)12-10-9-11-13-17(8-3)14-16(5)7-2/h13,15-16H,6-12,14H2,1-5H3 |
| InChIKey | PQUOTMZXNDIWTA-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 238.46 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-ethyl-3,11-dimethyltridec-5-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-3,11-dimethyltridec-5-ene?
The IUPAC name of 5-ethyl-3,11-dimethyltridec-5-ene (CID 123408628) is 5-ethyl-3,11-dimethyltridec-5-ene.
What is the SMILES notation for 5-ethyl-3,11-dimethyltridec-5-ene?
The canonical SMILES for 5-ethyl-3,11-dimethyltridec-5-ene is CCC(=CCCCCC(C)CC)CC(C)CC.
What is the InChIKey of 5-ethyl-3,11-dimethyltridec-5-ene?
The InChIKey is PQUOTMZXNDIWTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H34/c1-6-15(4)12-10-9-11-13-17(8-3)14-16(5)7-2/h13,15-16H,6-12,14H2,1-5H3.
What are the key properties of 5-ethyl-3,11-dimethyltridec-5-ene?
5-ethyl-3,11-dimethyltridec-5-ene has a molecular weight of 238.46 g/mol, XLogP of 6.37, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-3,11-dimethyltridec-5-ene is sourced from PubChem (CID 123408628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).