C11H19N3O — CID 123410900
1-(5-ethyl-4,5-dihydropyrimidin-2-yl)piperidin-4-ol (PubChem CID 123410900) has the molecular formula C11H19N3O and a molecular weight of 209.29 g/mol. Its IUPAC name is 1-(5-ethyl-4,5-dihydropyrimidin-2-yl)piperidin-4-ol.
| Compound Name | 1-(5-ethyl-4,5-dihydropyrimidin-2-yl)piperidin-4-ol |
|---|---|
| PubChem CID | 123410900 |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.15 |
| IUPAC Name | 1-(5-ethyl-4,5-dihydropyrimidin-2-yl)piperidin-4-ol |
| SMILES | CCC1C=NC(N2CCC(O)CC2)=NC1 |
| InChI | InChI=1S/C11H19N3O/c1-2-9-7-12-11(13-8-9)14-5-3-10(15)4-6-14/h7,9-10,15H,2-6,8H2,1H3 |
| InChIKey | BQMUACIYXCVLPV-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 48.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |