About N-[1-(4-hydroxypiperidin-1-yl)-2-methylpropylidene]-N'-methylethanimidamide
N-[1-(4-hydroxypiperidin-1-yl)-2-methylpropylidene]-N'-methylethanimidamide (PubChem CID 163764373) has the molecular formula C12H23N3O
and a molecular weight of 225.34 g/mol. Its IUPAC name is N-[1-(4-hydroxypiperidin-1-yl)-2-methylpropylidene]-N'-methylethanimidamide.
Molecular Properties
| Compound Name | N-[1-(4-hydroxypiperidin-1-yl)-2-methylpropylidene]-N'-methylethanimidamide |
| PubChem CID | 163764373 |
| Molecular Formula | C12H23N3O |
| Molecular Weight | 225.34 g/mol |
| Exact Mass | 225.18 |
| IUPAC Name | N-[1-(4-hydroxypiperidin-1-yl)-2-methylpropylidene]-N'-methylethanimidamide |
| SMILES | C/N=C(C)/N=C(\C(C)C)N1CCC(O)CC1 |
| InChI | InChI=1S/C12H23N3O/c1-9(2)12(14-10(3)13-4)15-7-5-11(16)6-8-15/h9,11,16H,5-8H2,1-4H3/b13-10+,14-12+ |
| InChIKey | MAZDUVSFLJIGGQ-ADWQEOMMSA-N |
| XLogP | 1.55 |
| TPSA | 48.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.34 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[1-(4-hydroxypiperidin-1-yl)-2-methylpropylidene]-N'-methylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-(4-hydroxypiperidin-1-yl)-2-methylpropylidene]-N'-methylethanimidamide?
The IUPAC name of N-[1-(4-hydroxypiperidin-1-yl)-2-methylpropylidene]-N'-methylethanimidamide (CID 163764373) is N-[1-(4-hydroxypiperidin-1-yl)-2-methylpropylidene]-N'-methylethanimidamide.
What is the SMILES notation for N-[1-(4-hydroxypiperidin-1-yl)-2-methylpropylidene]-N'-methylethanimidamide?
The canonical SMILES for N-[1-(4-hydroxypiperidin-1-yl)-2-methylpropylidene]-N'-methylethanimidamide is C/N=C(C)/N=C(\C(C)C)N1CCC(O)CC1.
What is the InChIKey of N-[1-(4-hydroxypiperidin-1-yl)-2-methylpropylidene]-N'-methylethanimidamide?
The InChIKey is MAZDUVSFLJIGGQ-ADWQEOMMSA-N. The full InChI is InChI=1S/C12H23N3O/c1-9(2)12(14-10(3)13-4)15-7-5-11(16)6-8-15/h9,11,16H,5-8H2,1-4H3/b13-10+,14-12+.
What are the key properties of N-[1-(4-hydroxypiperidin-1-yl)-2-methylpropylidene]-N'-methylethanimidamide?
N-[1-(4-hydroxypiperidin-1-yl)-2-methylpropylidene]-N'-methylethanimidamide has a molecular weight of 225.34 g/mol, XLogP of 1.55, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-(4-hydroxypiperidin-1-yl)-2-methylpropylidene]-N'-methylethanimidamide is sourced from PubChem (CID 163764373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).