About 1-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)propan-2-ol
1-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)propan-2-ol (PubChem CID 70357606) has the molecular formula C8H16N2O
and a molecular weight of 156.23 g/mol. Its IUPAC name is 1-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)propan-2-ol.
Analyze 1-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)propan-2-ol?
The IUPAC name of 1-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)propan-2-ol (CID 70357606) is 1-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)propan-2-ol.
What is the SMILES notation for 1-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)propan-2-ol?
The canonical SMILES for 1-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)propan-2-ol is CC(O)CC1=NCCCN1C.
What is the InChIKey of 1-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)propan-2-ol?
The InChIKey is VKDQIYTWPXKOBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16N2O/c1-7(11)6-8-9-4-3-5-10(8)2/h7,11H,3-6H2,1-2H3.
What are the key properties of 1-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)propan-2-ol?
1-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)propan-2-ol has a molecular weight of 156.23 g/mol, XLogP of 0.49, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-methyl-5,6-dihydro-4H-pyrimidin-2-yl)propan-2-ol is sourced from PubChem (CID 70357606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).