C18H14BrNO3 — CID 1234118
3-bromo-N-(4,7-dimethyl-2-oxochromen-6-yl)benzamide (PubChem CID 1234118) has the molecular formula C18H14BrNO3 and a molecular weight of 372.22 g/mol. Its IUPAC name is 3-bromo-N-(4,7-dimethyl-2-oxochromen-6-yl)benzamide.
| Compound Name | 3-bromo-N-(4,7-dimethyl-2-oxochromen-6-yl)benzamide |
|---|---|
| PubChem CID | 1234118 |
| Molecular Formula | C18H14BrNO3 |
| Molecular Weight | 372.22 g/mol |
| Exact Mass | 371.02 |
| IUPAC Name | 3-bromo-N-(4,7-dimethyl-2-oxochromen-6-yl)benzamide |
| SMILES | Cc1cc2oc(=O)cc(C)c2cc1NC(=O)c1cccc(Br)c1 |
| InChI | InChI=1S/C18H14BrNO3/c1-10-7-17(21)23-16-6-11(2)15(9-14(10)16)20-18(22)12-4-3-5-13(19)8-12/h3-9H,1-2H3,(H,20,22) |
| InChIKey | HQCPXFZOGUNKMW-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.22 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|